You are here: CHINACSKY >Agriculture>Feed>Horse Feed

Horse Feed

There are about 205 Horse Feed product records here, About 6 Page(s). The Horse Feed supplier link at the right of the page, you can get their contact info.

Magnesium-fortified horse salt brick press machine
1. Type:Salt Lick
2. Use:Cattle, Horse, Pig, Other
3. Place of Origin:Jiangsu China (Mainland)
4. Brand Name:wick
5. Model Number:syst-500
6. Production Capacity:4 sets per minute
Supplier:Jintan Wick Tablet Machinery Manufacturing Co., Ltd.
Corn Gluten Animal Feed
1. Type:Grain
2. Variety:Corn Gluten Meal
3. Use:Cattle, Chicken, Dog, Fish, Horse, Pig
4. Moisture (%):7-10%
5. Grade:Top Grade
6. Packaging:50kg/bag
7. Place of Origin:Shandong China (Mainland)
8. Brand Name:Huijia
9. Protein:17-20%(wet basis)
10. Moisture:7-10%
Supplier:Huijia Biochemical International Co., Ltd.
Rice protein powder (Feed grade)
1. Type:Grain
2. Use:Cattle, Chicken, Dog, Fish, Horse, Pig, Ot...
3. Admixture (%):0
4. Moisture (%):Equal to or less than 10
5. Grade:A
6. Packaging:30-50kg bag or as customer's option
7. Brand Name:HUIJIA
8. Model Number:Feed Grade
9. Color:Pale yellow
10. Protein Content:>60%
11. Fat Content:<8%
12. Moisture Content:<10%
13. Supply Ability:500 Metric Ton/Metric Tons per ...
14. Delivery Time:two weeks
Supplier:Huijia Biochemical International Co., Ltd.
Cheap Price Corn Straw Pellet For Fuel in Bulk
1. Type:Grain
2. Variety:Corn Straw
3. Use:Cattle, Horse, Pig, also for Animal Beddin...
4. Admixture (%):<0.1%
5. Moisture (%):10%
6. Grade:High-class
7. Packaging:50kg bags
8. Place of Origin:Liaoning China (Mainland)
9. Brand Name:Granergy
10. Model Number:CSP-010
11. Color:Nature
12. Raw Material:Corn Straw
13. Length:10-30mm
14. Diameter:8mm
Supplier:Liaoning Modern Agricultural Machine Equipment Co., Ltd.
Feed Grade Betaine HCL
1. Type:Beet Pulp
2. Use:Cattle, Chicken, Dog, Fish, Horse, Pig
3. Admixture (%):4%
4. Moisture (%):2%
5. Grade:A
6. Packaging:Cardboard box(inner plastic bags)
7. Place of Origin:Shandong China (Mainland)
8. Brand Name:QLZM
9. Model Number:2011-03-01
10. Squamous or prismatic crystals powder:Soluble ...
Supplier:Jinan QiLu ZhongMu Biotechnology Co., Ltd.
CE livestock feed pellet production line
1. Use:Cattle, Chicken, Horse, Pig, sheep, camel
2. Place of Origin:Jiangsu China (Mainland)
3. Brand Name:YONGLI
4. Capacity:1-30TPH
5. Certificate:CE
6. Warranty:1 year
7. Service:All round after sale service
Supplier:Liyang Yongli Agro Machinery Co., Ltd.
Spare Part
1. Type:Grain
2. Use:Cattle, Chicken, Dog, Fish, Horse, Pig
3. Place of Origin:Jiangsu China (Mainland)
4. Brand Name:Zhongding
Supplier:Liyang Zhongding Feed Machinery Factory
Threonine 98.5%
1. Type:L-Threonine
2. Use:Cattle, Chicken, Dog, Fish, Horse, Pig
3. Moisture (%):1.0%max
4. Grade:AA
5. Packaging:25kg or 50kg pp bag or as your need
6. Place of Origin:Shandong China (Mainland)
7. Model Number:98.5%
MOQ: 17.5 Metric Tons
Supplier:Wudi Zhangta Changcheng Co., Limited
Corn stalk cattle feed
1. Type:Other
2. Use:Cattle, Horse, deer goose
3. Admixture (%):0.5%
4. Moisture (%):14%
5. Grade:I
6. Packaging:BAG
7. Place of Origin:Jilin China (Mainland)
8. Feed density: 0.9-1.1g/cm3
9. Crude fibre:≤35.5%
10. Crude protein:≥3.5%
11. Cride fat: ≥ 0.6%
12. P:≥ 0.08%
13. CA:≥ 0.35%
14. feed diameter:68mm
MOQ: 10 Tons
Supplier:Dalian Chem Imp. & Exp. Group Co., Ltd.
Fish Meal-feed additive of animal feed
1. Type:animal feed made of fish
2. Use:Cattle, Chicken, Dog, Fish, Horse, Pig, du...
3. Moisture (%):10% max
4. Grade:feed grade
5. Packaging:in PP or kraft bag
6. Place of Origin:Shandong China (Mainland)
7. Brand Name:SHUNTONG
8. Model Number:FY-65
9. color:yellow, yellow-brown
MOQ: 20 Tons
Supplier:Wudi Shuntong Biological Development Co., Ltd.
Corn Gluten Meal,
1. Type:Grain
2. Variety:Corn Gluten Meal
3. Use:Cattle, Chicken, Dog, Fish, Horse, Pig, sh...
4. Moisture (%):10max
5. Grade:feed grade
6. Packaging:50kg pp bag
7. Place of Origin:Shandong China (Mainland)
8. Brand Name:Runsheng
9. moisture:<10%
10. packing:50kg pp bag ton bag or accoding t...
11. color:yellow and brown
12. protein:>60%
13. fat:<5.0%
14. grade:feed additive
MOQ: 20 Tons, Price: US $650-720 / Ton
Supplier:Zhucheng Runsheng Starch Co., Ltd.
magnesium oxide for feed grade
1. Type:magnesium oxide feed grade
2. Use:Cattle, Chicken, Dog, Horse, Pig
3. Grade:first class
4. Packaging:pp woven bag lining with pe film
5. Place of Origin:Liaoning China (Mainland)
6. Brand Name:tilin
7. Model Number:feed
Supplier:Shijiazhuang Tilin Technology Co., Ltd.
Lysine HCL 98.5%
1. Type:L-lysine HCL
2. Use:Cattle, Chicken, Dog, Fish, Horse, Pig, Ot...
3. Moisture (%):<=1.0%
4. Grade:AA degree
5. Packaging:25KG PP BAG
6. Place of Origin:China (Mainland)
7. Brand Name:Brother
8. Model Number:HCL 98.5%
9. Color:Light yellow
MOQ: 16.5 Metric Tons, Price: US $2300-2800 / Metric Ton
Supplier:Wudi Longteng Co., Limited
Copper sulphate pentahydrate fertilizer
1. Type: Trace elements of additives
2. Use:Cattle, Dog, Horse, Pig, Rabbit
3. Grade:Feed grade
4. Packaging:25kgs/bag,50kgs/bag
5. Place of Origin:China (Mainland)
6. Brand Name:Runzi
Supplier:Zouping Runzi Chemical Industry Co., Ltd.
Fodder Pellet Making Equipment
1. Type:Pellet Feed
2. Use:Cattle, Chicken, Dog, Fish, Horse, Pig, Ot...
3. Place of Origin:Henan China (Mainland)
4. Brand Name:GEMCO
5. Model Number:ZLSP150A D-Type
6. Quality certificate:CE, ISO9001
7. Original place:Anyang
8. Engine:diesel engine
9. Energy and labor consumption:low
10. Spare part:roller and flat die
11. Material of flat die:high grad complex alloy s...
12. Pellet diameter:choosable
13. Operation:simple automatic operation
14. Running:24 hours continuous runing
15. Maintainance:easy
Supplier:Anyang Gemco Energy Machinery Co., Ltd.
DDGS
1. Type:DDGS
2. Use:Cattle, Horse
3. Moisture (%):13
4. Grade:FEED GRADE
5. Packaging:50 KG/BAG
6. Place of Origin:China (Mainland)
7. Brand Name:FS
8. Model Number:FS-5-2
9. Cassava:POWDER
Supplier:FUSHISHAN INDUSTRIAL CO LTD
Wheat Gluten Meal (feed grade) (SXR2011)
1. Type:Grain
2. Use:Cattle, Chicken, Dog, Fish, Horse, Pig, Ot...
Supplier:Guanxian Ruixiang Biotechnology Development Co., Ltd.
Choline Chloride 60% corn cob
1. Type:animal feed additive
2. Use:Cattle, Chicken, Fish, Horse, Pig
3. Grade:the best
4. Packaging:bag
5. Place of Origin:Hebei China (Mainland)
6. Brand Name:Xindewei
7. Model Number:Powder
8. color:light yellow
9. Certification:ISO 9001
10. CAS NO.:67-48-1
11. Puriy:60%
Supplier:Cangzhou Huayou Import & Export Trade Co., Ltd.
l-lysine HCL ---98.5%
1. Type:lysine HCL 98.5%
2. Use:Cattle, Chicken, Dog, Fish, Horse, Pig
3. Moisture (%):<=1.0
4. Grade:AA
5. Packaging:25kg or 50kg PE bags
6. Place of Origin:Shandong China (Mainland)
7. Brand Name:lysine
MOQ: 40 Metric Tons, Price: US $1900-2800 / Ton
Supplier:Wudi Zhangta Changcheng Co., Limited
10% Colistin Sulphate Premix
1. Use:Cattle, Chicken, Dog, Fish, Horse, Pig
2. Place of Origin:Shanxi China (Mainland)
3. Brand Name:haoyue
4. Dosage Form:powder
MOQ: 100 Kilograms
Supplier:Shanxi Banyue Animal Pharmaceutical Co., Ltd.
Copper Sulphate Pentahydrate (cuso4. 5H2o) 98%
1. Type:cuso4
2. Use:Cattle, Chicken, Dog, Fish, Horse, Pig, fe...
3. Grade:98.5% feed grade
4. Packaging:25kg pp bag, 24T/20'FCL
5. Place of Origin:Hebei China (Mainland)
6. Brand Name:ZPCOPPER
7. grade:98.5%
8. color:blue
MOQ: 10 Tons, Price: US $2500 / Ton
Supplier:Shijiazhuang Zhuopeng Copper Co., Ltd.
most useful and welcomed stalk rubbing crusher
1. Type:Hay
2. Variety:Grain Hay
3. Use:Cattle, Chicken, Dog, Horse, Pig, Other
4. Grade:1grade
5. Packaging:no package
6. Place of Origin:Henan China (Mainland)
7. Brand Name:RFL
8. Model Number:RSJ
9. color:blue
MOQ: 1 Set
Supplier:Zhengzhou Rephale Machinery Co., Ltd.
animal feed
1. Type:Hay
2. Variety:Mulberry leaves
3. Use:Cattle, Chicken, Horse, Pig, cow
4. Admixture (%):0.002
5. Grade:first
6. Packaging:plasticbags
7. Place of Origin:Xinjiang China (Mainland)
8. Brand Name:silv
9. Model Number:silv
10. color:green
MOQ: 10 Tons, Price: US $0.1-10 / Bag
Supplier:Silvcorp (Qingdao) Co., Ltd.
Feed additive Choline Chloride 50% Corn cob powder
1. Use:Cattle, Chicken, Horse, Pig, sheep
2. Moisture (%):2% max
3. Grade:feed griade
4. Packaging:25kg WPP Bags (18tons/FCL)
5. Place of Origin:Hebei China (Mainland)
6. Brand Name:Pangoo
7. Model Number:cc50
8. CAS No.:67-48-1
9. Einecs No.:200-655-4
10. Appearance::Yellow-brownish free flowing powde...
11. Choline chloride content::50% min
MOQ: 10 Tons, Price: US $300-1000 / Ton
Supplier:Cangzhou Pangoo International Trade Co., Ltd.
beet pulp
1. Type:Beet Pulp
2. Use:Cattle, Chicken, Horse, Pig
3. Admixture (%):4.5%
4. Moisture (%):13%
5. Packaging:50 kg bag
6. Place of Origin:Xinjiang China (Mainland)
MOQ: 200 Tons
Supplier:Beijing Silver Angel International Trading Co., Ltd.
Feed Grade Choline Chloride 70% corn cob feed additive
1. Type:corn cob
2. Use:Cattle, Chicken, Fish, Horse, Pig
3. Moisture (%):2% max
4. Grade:Feed Grade
5. Packaging:25kg WPP Bags (17tons/FCL)
6. Place of Origin:Hebei China (Mainland)
7. Brand Name:Pangoo
8. Model Number:cc70
9. CAS No.:: 67-48-1
10. Einecs No.::200-655-4
11. Molecular Formula:HOCH2CH2N(CH3)3Cl
12. Appearance::Yellow-brownish free flowing powde...
Supplier:Cangzhou Pangoo International Trade Co., Ltd.
Cotton seed Meal
1. Use:Cattle, Horse, Pig, Other
Supplier:Rizhao Hengxin Industry & Trade Corp.
Chicken feed Sonergy
1. Use:Cattle, Chicken, Dog, Fish, Horse, Pig, Ot...
2. Admixture (%):0.05% Max
3. Moisture (%):6% Max
4. Grade:Super
5. Packaging:Water proof knitting bag
6. Place of Origin:Shandong China (Mainland)
7. Brand Name:ZHONGDA
8. Model Number:Q/ZMK001-201
9. Chicken feed:duck feed
MOQ: 20 Tons, Price: US $1-2000 / Ton
Supplier:Xiamen Nanyang Ma-Zhong Import Export Co., Ltd.
hot sale DDGS Agriculture with Animal Feed
1. Type:Grain
2. Variety:Corn Gluten Meal
3. Use:Cattle, Chicken, Dog, Fish, Horse, Pig, an...
4. Moisture (%):max 8%
5. Grade:grade good
6. Packaging:packing bag
7. Place of Origin:Shandong China (Mainland)
8. Brand Name:shuangxin
9. Model Number:DDGS
10. use:Cattle, Chicken, Dog, Fish, Horse, Pig
11. Moisture:max 10%
12. color:yellow
13. Protein:min26%
MOQ: 20 Tons, Price: US $300-400 / Ton
Supplier:Qingzhou Shuangxin Trading Co., Ltd.
40% amoxicillin premixes
1. Use:Cattle, Chicken, Dog, Fish, Horse, Pig
2. Place of Origin:Shanxi China (Mainland)
3. Brand Name:haoyue
4. Type::Antibiotic and Antimicrobial Agents
MOQ: 10 Kilograms
Supplier:Shanxi Banyue Animal Pharmaceutical Co., Ltd.
Supply animal feed Barley
1. Type:Grain
2. Variety:Wheat Bran
3. Use:Cattle, Horse, Pig
4. Admixture (%):0.1%
5. Moisture (%):10%
6. Grade:A
7. Packaging:25 kg pp bags
8. Place of Origin:Hebei China (Mainland)
9. Brand Name:Guoyue
10. color:light yellow
MOQ: 10 Tons, Price: US $200-500 / Ton
Supplier:Xingtai Guoyue Import And Export Trade Co., Ltd.
dog food machine
1. Type:Fish Meal
2. Use:Cattle, Chicken, Dog, Fish, Horse, Pig
3. Packaging:plywood box
4. Place of Origin:Anhui China (Mainland)
5. Brand Name:sinosh
6. Model Number:SS-40PM ,120PFM,300PEM
7. steel:while
MOQ: 1 Unit, Price: US $4000-8000 / Unit
Supplier:Anyang Friend Diamond Tools Co., Ltd.
cottonseed meal
1. Type:Seeds
2. Variety:Cotton Seed Meal
3. Use:Cattle, Chicken, Dog, Fish, Horse, Pig
4. Admixture (%):none
5. Grade:feed grade
6. Packaging:woven bag
7. Place of Origin:Shandong China (Mainland)
8. color:yellow
MOQ: 100 Metric Tons
Supplier:Lianyungang Suneng Trade Co., Ltd.
Plastic Horse Feed Bucket
1. Type:Water
2. Use:Horse
3. Place of Origin:Hubei China (Mainland)
4. Brand Name:Red Star
5. Model Number:12-025
Supplier:Wuhan Red Star Agro-Livestock Machinery Co., Ltd.
Plastic Horse Feed Bucket
1. Type:Water
2. Use:Horse
3. Place of Origin:Hubei China (Mainland)
4. Brand Name:Red Star
5. Model Number:12-025
MOQ: 1000 Pieces, Price: US $0.61-1.23 / Piece
Supplier:Wuhan Red Star Agro-Livestock Machinery Co., Ltd.
Microalgae Powder DHA 18%
1. Type:Seaweed
2. Use:Cattle, Chicken, Dog, Fish, Horse, Pig
3. Place of Origin:China (Mainland)
MOQ: 100 Kilograms
Supplier:Beijing Songtaohengye International Trade Co., Ltd.
2T/H efficient animal food pellet equipment
1. Type:Grain
2. Use:Cattle, Chicken, Dog, Fish, Horse, Pig
3. Grade:first class
4. Place of Origin:Shandong China (Mainland)
5. Brand Name:YULONG
6. Model Number:HKJ300 granulator
7. color:yellow or for your need
8. power(kw):45
9. capacity(t/h):1.5-2.5
10. certificate:CE SGS ISO9000
11. current requirement:380V 50HZ 3PH
12. type:ring die pellet mill
MOQ: 1 Set, Price: US $800-500000 / Set
Supplier:Zhangqiu Yulong Machine Co., Ltd.
Bacillus Subtilis
1. Type:feed additives
2. Use:Cattle, Chicken, Fish, Horse, Pig, promote...
3. Admixture (%):lower than 5%
4. Moisture (%):lower than 5%
5. Grade:perfect
6. Packaging:25kgs/bag or drum
7. Place of Origin:Hebei China (Mainland)
8. Brand Name:Junnuo
9. Model Number:1*10*10cfu/g
10. color:yellow
11. appearance:powder
12. authentication:ISO9000
13. name:Bacillus Subtilis
14. package:25kg/bag(drum)
15. Smell:Light fermentation smell
16. Fineness:80~200 meshes
MOQ: 1 Ton
Supplier:Cangzhou City Zhongxin Biotechnology Co., Ltd.

Pages: First 1 2 3 4 5 6 Next End

Are you Looking for Horse Feed ? You’ve come to the right place. This page is your Horse Feed one-stop source for the competitive price and quality. If you can't find a right supplier, Submit your Buying Leads for FREE now!